About 1-ethenyl-4-(4-methylphenyl)benzene;hexane
1-ethenyl-4-(4-methylphenyl)benzene;hexane (PubChem CID 142178486) has the molecular formula C21H28
and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-ethenyl-4-(4-methylphenyl)benzene;hexane.
Molecular Properties
| Compound Name | 1-ethenyl-4-(4-methylphenyl)benzene;hexane |
| PubChem CID | 142178486 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-ethenyl-4-(4-methylphenyl)benzene;hexane |
| SMILES | C=Cc1ccc(-c2ccc(C)cc2)cc1.CCCCCC |
| InChI | InChI=1S/C15H14.C6H14/c1-3-13-6-10-15(11-7-13)14-8-4-12(2)5-9-14;1-3-5-6-4-2/h3-11H,1H2,2H3;3-6H2,1-2H3 |
| InChIKey | VYDZVHZWONJQGJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-(4-methylphenyl)benzene;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-(4-methylphenyl)benzene;hexane?
The IUPAC name of 1-ethenyl-4-(4-methylphenyl)benzene;hexane (CID 142178486) is 1-ethenyl-4-(4-methylphenyl)benzene;hexane.
What is the SMILES notation for 1-ethenyl-4-(4-methylphenyl)benzene;hexane?
The canonical SMILES for 1-ethenyl-4-(4-methylphenyl)benzene;hexane is C=Cc1ccc(-c2ccc(C)cc2)cc1.CCCCCC.
What is the InChIKey of 1-ethenyl-4-(4-methylphenyl)benzene;hexane?
The InChIKey is VYDZVHZWONJQGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.C6H14/c1-3-13-6-10-15(11-7-13)14-8-4-12(2)5-9-14;1-3-5-6-4-2/h3-11H,1H2,2H3;3-6H2,1-2H3.
What are the key properties of 1-ethenyl-4-(4-methylphenyl)benzene;hexane?
1-ethenyl-4-(4-methylphenyl)benzene;hexane has a molecular weight of 280.46 g/mol, XLogP of 6.89, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-(4-methylphenyl)benzene;hexane is sourced from PubChem (CID 142178486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).