About 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane
1-butan-2-yl-4-methylbenzene;formaldehyde;heptane (PubChem CID 142152659) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane.
Molecular Properties
| Compound Name | 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane |
| PubChem CID | 142152659 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane |
| SMILES | C=O.C=O.CCC(C)c1ccc(C)cc1.CCCCCCC |
| InChI | InChI=1S/C11H16.C7H16.2CH2O/c1-4-10(3)11-7-5-9(2)6-8-11;1-3-5-7-6-4-2;2*1-2/h5-8,10H,4H2,1-3H3;3-7H2,1-2H3;2*1H2 |
| InChIKey | KLXHGMLJTKIQSC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane?
The IUPAC name of 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane (CID 142152659) is 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane.
What is the SMILES notation for 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane?
The canonical SMILES for 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane is C=O.C=O.CCC(C)c1ccc(C)cc1.CCCCCCC.
What is the InChIKey of 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane?
The InChIKey is KLXHGMLJTKIQSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C7H16.2CH2O/c1-4-10(3)11-7-5-9(2)6-8-11;1-3-5-7-6-4-2;2*1-2/h5-8,10H,4H2,1-3H3;3-7H2,1-2H3;2*1H2.
What are the key properties of 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane?
1-butan-2-yl-4-methylbenzene;formaldehyde;heptane has a molecular weight of 308.51 g/mol, XLogP of 6.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4-methylbenzene;formaldehyde;heptane is sourced from PubChem (CID 142152659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).