About 1-chloro-4-methylbenzene;pentane
1-chloro-4-methylbenzene;pentane (PubChem CID 142041532) has the molecular formula C12H19Cl
and a molecular weight of 198.74 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;pentane.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene;pentane |
| PubChem CID | 142041532 |
| Molecular Formula | C12H19Cl |
| Molecular Weight | 198.74 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-chloro-4-methylbenzene;pentane |
| SMILES | CCCCC.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7Cl.C5H12/c1-6-2-4-7(8)5-3-6;1-3-5-4-2/h2-5H,1H3;3-5H2,1-2H3 |
| InChIKey | QDXHQGWJUZXRAS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-4-methylbenzene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene;pentane?
The IUPAC name of 1-chloro-4-methylbenzene;pentane (CID 142041532) is 1-chloro-4-methylbenzene;pentane.
What is the SMILES notation for 1-chloro-4-methylbenzene;pentane?
The canonical SMILES for 1-chloro-4-methylbenzene;pentane is CCCCC.Cc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-methylbenzene;pentane?
The InChIKey is QDXHQGWJUZXRAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.C5H12/c1-6-2-4-7(8)5-3-6;1-3-5-4-2/h2-5H,1H3;3-5H2,1-2H3.
What are the key properties of 1-chloro-4-methylbenzene;pentane?
1-chloro-4-methylbenzene;pentane has a molecular weight of 198.74 g/mol, XLogP of 4.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;pentane is sourced from PubChem (CID 142041532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).