About decane;1-methyl-4-(4-methylphenoxy)benzene;octane
decane;1-methyl-4-(4-methylphenoxy)benzene;octane (PubChem CID 90840251) has the molecular formula C32H54O
and a molecular weight of 454.78 g/mol. Its IUPAC name is decane;1-methyl-4-(4-methylphenoxy)benzene;octane.
Molecular Properties
| Compound Name | decane;1-methyl-4-(4-methylphenoxy)benzene;octane |
| PubChem CID | 90840251 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | decane;1-methyl-4-(4-methylphenoxy)benzene;octane |
| SMILES | CCCCCCCC.CCCCCCCCCC.Cc1ccc(Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14O.C10H22.C8H18/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-3-5-7-9-10-8-6-4-2;1-3-5-7-8-6-4-2/h3-10H,1-2H3;3-10H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | FQHSLBBUZRBYEF-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane;1-methyl-4-(4-methylphenoxy)benzene;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane;1-methyl-4-(4-methylphenoxy)benzene;octane?
The IUPAC name of decane;1-methyl-4-(4-methylphenoxy)benzene;octane (CID 90840251) is decane;1-methyl-4-(4-methylphenoxy)benzene;octane.
What is the SMILES notation for decane;1-methyl-4-(4-methylphenoxy)benzene;octane?
The canonical SMILES for decane;1-methyl-4-(4-methylphenoxy)benzene;octane is CCCCCCCC.CCCCCCCCCC.Cc1ccc(Oc2ccc(C)cc2)cc1.
What is the InChIKey of decane;1-methyl-4-(4-methylphenoxy)benzene;octane?
The InChIKey is FQHSLBBUZRBYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C10H22.C8H18/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-3-5-7-9-10-8-6-4-2;1-3-5-7-8-6-4-2/h3-10H,1-2H3;3-10H2,1-2H3;3-8H2,1-2H3.
What are the key properties of decane;1-methyl-4-(4-methylphenoxy)benzene;octane?
decane;1-methyl-4-(4-methylphenoxy)benzene;octane has a molecular weight of 454.78 g/mol, XLogP of 11.61, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decane;1-methyl-4-(4-methylphenoxy)benzene;octane is sourced from PubChem (CID 90840251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).