C18H24O3 — CID 70420905
butane-1,1-diol;1-methyl-4-(4-methylphenoxy)benzene (PubChem CID 70420905) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is butane-1,1-diol;1-methyl-4-(4-methylphenoxy)benzene.
| Compound Name | butane-1,1-diol;1-methyl-4-(4-methylphenoxy)benzene |
|---|---|
| PubChem CID | 70420905 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | butane-1,1-diol;1-methyl-4-(4-methylphenoxy)benzene |
| SMILES | CCCC(O)O.Cc1ccc(Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14O.C4H10O2/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-2-3-4(5)6/h3-10H,1-2H3;4-6H,2-3H2,1H3 |
| InChIKey | XBPMSNABXBSAEA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|