About (4-methylphenyl) decane-1-sulfonate
(4-methylphenyl) decane-1-sulfonate (PubChem CID 87380183) has the molecular formula C17H28O3S
and a molecular weight of 312.47 g/mol. Its IUPAC name is (4-methylphenyl) decane-1-sulfonate.
Molecular Properties
| Compound Name | (4-methylphenyl) decane-1-sulfonate |
| PubChem CID | 87380183 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (4-methylphenyl) decane-1-sulfonate |
| SMILES | CCCCCCCCCCS(=O)(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C17H28O3S/c1-3-4-5-6-7-8-9-10-15-21(18,19)20-17-13-11-16(2)12-14-17/h11-14H,3-10,15H2,1-2H3 |
| InChIKey | UICONWYWLSQCGU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) decane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) decane-1-sulfonate?
The IUPAC name of (4-methylphenyl) decane-1-sulfonate (CID 87380183) is (4-methylphenyl) decane-1-sulfonate.
What is the SMILES notation for (4-methylphenyl) decane-1-sulfonate?
The canonical SMILES for (4-methylphenyl) decane-1-sulfonate is CCCCCCCCCCS(=O)(=O)Oc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl) decane-1-sulfonate?
The InChIKey is UICONWYWLSQCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3S/c1-3-4-5-6-7-8-9-10-15-21(18,19)20-17-13-11-16(2)12-14-17/h11-14H,3-10,15H2,1-2H3.
What are the key properties of (4-methylphenyl) decane-1-sulfonate?
(4-methylphenyl) decane-1-sulfonate has a molecular weight of 312.47 g/mol, XLogP of 4.84, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) decane-1-sulfonate is sourced from PubChem (CID 87380183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).