About [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate
[4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate (PubChem CID 19763206) has the molecular formula C28H36N2O3S
and a molecular weight of 480.67 g/mol. Its IUPAC name is [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate.
Molecular Properties
| Compound Name | [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate |
| PubChem CID | 19763206 |
| Molecular Formula | C28H36N2O3S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)Oc1ccc(N(C)c2ccc(N(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H36N2O3S/c1-4-5-6-7-8-12-23-34(31,32)33-28-21-19-27(20-22-28)30(3)26-17-15-25(16-18-26)29(2)24-13-10-9-11-14-24/h9-11,13-22H,4-8,12,23H2,1-3H3 |
| InChIKey | GNGYEERBYCAHNX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate?
The IUPAC name of [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate (CID 19763206) is [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate.
What is the SMILES notation for [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate?
The canonical SMILES for [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate is CCCCCCCCS(=O)(=O)Oc1ccc(N(C)c2ccc(N(C)c3ccccc3)cc2)cc1.
What is the InChIKey of [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate?
The InChIKey is GNGYEERBYCAHNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36N2O3S/c1-4-5-6-7-8-12-23-34(31,32)33-28-21-19-27(20-22-28)30(3)26-17-15-25(16-18-26)29(2)24-13-10-9-11-14-24/h9-11,13-22H,4-8,12,23H2,1-3H3.
What are the key properties of [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate?
[4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate has a molecular weight of 480.67 g/mol, XLogP of 7.29, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[N-methyl-4-(N-methylanilino)anilino]phenyl] octane-1-sulfonate is sourced from PubChem (CID 19763206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).