C14H14O6S2 — CID 4219954
diphenyl ethane-1,2-disulfonate (PubChem CID 4219954) has the molecular formula C14H14O6S2 and a molecular weight of 342.39 g/mol. Its IUPAC name is diphenyl ethane-1,2-disulfonate.
| Compound Name | diphenyl ethane-1,2-disulfonate |
|---|---|
| PubChem CID | 4219954 |
| Molecular Formula | C14H14O6S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | diphenyl ethane-1,2-disulfonate |
| SMILES | O=S(=O)(CCS(=O)(=O)Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C14H14O6S2/c15-21(16,19-13-7-3-1-4-8-13)11-12-22(17,18)20-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | BMMAMSYHVLNKPY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|