About sodium;hydride;phenyl propane-1-sulfonate
sodium;hydride;phenyl propane-1-sulfonate (PubChem CID 174291671) has the molecular formula C9H13NaO3S
and a molecular weight of 224.26 g/mol. Its IUPAC name is sodium;hydride;phenyl propane-1-sulfonate.
Molecular Properties
| Compound Name | sodium;hydride;phenyl propane-1-sulfonate |
| PubChem CID | 174291671 |
| Molecular Formula | C9H13NaO3S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | sodium;hydride;phenyl propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C9H12O3S.Na.H/c1-2-8-13(10,11)12-9-6-4-3-5-7-9;;/h3-7H,2,8H2,1H3;;/q;+1;-1 |
| InChIKey | WCRKVBUNVKLNQS-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenyl propane-1-sulfonate?
The IUPAC name of sodium;hydride;phenyl propane-1-sulfonate (CID 174291671) is sodium;hydride;phenyl propane-1-sulfonate.
What is the SMILES notation for sodium;hydride;phenyl propane-1-sulfonate?
The canonical SMILES for sodium;hydride;phenyl propane-1-sulfonate is CCCS(=O)(=O)Oc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenyl propane-1-sulfonate?
The InChIKey is WCRKVBUNVKLNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S.Na.H/c1-2-8-13(10,11)12-9-6-4-3-5-7-9;;/h3-7H,2,8H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;phenyl propane-1-sulfonate?
sodium;hydride;phenyl propane-1-sulfonate has a molecular weight of 224.26 g/mol, XLogP of -1.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenyl propane-1-sulfonate is sourced from PubChem (CID 174291671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).