C9H13NaO3S3 — CID 174053492
sodium;hydride;phenyl 3,3-bis(sulfanyl)propane-1-sulfonate (PubChem CID 174053492) has the molecular formula C9H13NaO3S3 and a molecular weight of 288.39 g/mol. Its IUPAC name is sodium;hydride;phenyl 3,3-bis(sulfanyl)propane-1-sulfonate.
| Compound Name | sodium;hydride;phenyl 3,3-bis(sulfanyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 174053492 |
| Molecular Formula | C9H13NaO3S3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | sodium;hydride;phenyl 3,3-bis(sulfanyl)propane-1-sulfonate |
| SMILES | O=S(=O)(CCC(S)S)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C9H12O3S3.Na.H/c10-15(11,7-6-9(13)14)12-8-4-2-1-3-5-8;;/h1-5,9,13-14H,6-7H2;;/q;+1;-1 |
| InChIKey | NFGCQAXVTCPEQJ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|