About phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate
phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate (PubChem CID 87453116) has the molecular formula C32H36O3S3
and a molecular weight of 564.84 g/mol. Its IUPAC name is phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate.
Molecular Properties
| Compound Name | phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate |
| PubChem CID | 87453116 |
| Molecular Formula | C32H36O3S3 |
| Molecular Weight | 564.84 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)Oc1ccc(Sc2ccccc2)cc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26O3S2.C12H10S/c1-2-3-4-5-6-10-17-25(21,22)23-18-13-15-20(16-14-18)24-19-11-8-7-9-12-19;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h7-9,11-16H,2-6,10,17H2,1H3;1-10H |
| InChIKey | DYFMWHAQPAERIU-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.84 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate?
The IUPAC name of phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate (CID 87453116) is phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate.
What is the SMILES notation for phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate?
The canonical SMILES for phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate is CCCCCCCCS(=O)(=O)Oc1ccc(Sc2ccccc2)cc1.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate?
The InChIKey is DYFMWHAQPAERIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O3S2.C12H10S/c1-2-3-4-5-6-10-17-25(21,22)23-18-13-15-20(16-14-18)24-19-11-8-7-9-12-19;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h7-9,11-16H,2-6,10,17H2,1H3;1-10H.
What are the key properties of phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate?
phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate has a molecular weight of 564.84 g/mol, XLogP of 9.74, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylbenzene;(4-phenylsulfanylphenyl) octane-1-sulfonate is sourced from PubChem (CID 87453116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).