C44H58O10S3 — CID 54398091
[4-[4-decylsulfonyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] decane-1-sulfonate (PubChem CID 54398091) has the molecular formula C44H58O10S3 and a molecular weight of 843.14 g/mol. Its IUPAC name is [4-[4-decylsulfonyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] decane-1-sulfonate.
| Compound Name | [4-[4-decylsulfonyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] decane-1-sulfonate |
|---|---|
| PubChem CID | 54398091 |
| Molecular Formula | C44H58O10S3 |
| Molecular Weight | 843.14 g/mol |
| Exact Mass | 842.32 |
| IUPAC Name | [4-[4-decylsulfonyloxy-2-(4-hydroxyphenyl)phenyl]sulfonyl-3-(4-hydroxyphenyl)phenyl] decane-1-sulfonate |
| SMILES | CCCCCCCCCCS(=O)(=O)Oc1ccc(S(=O)(=O)c2ccc(OS(=O)(=O)CCCCCCCCCC)cc2-c2ccc(O)cc2)c(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C44H58O10S3/c1-3-5-7-9-11-13-15-17-31-55(47,48)53-39-27-29-43(41(33-39)35-19-23-37(45)24-20-35)57(51,52)44-30-28-40(34-42(44)36-21-25-38(46)26-22-36)54-56(49,50)32-18-16-14-12-10-8-6-4-2/h19-30,33-34,45-46H,3-18,31-32H2,1-2H3 |
| InChIKey | VLLIMGFSDJXULZ-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.14 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|