C15H24N2 — CID 62429801
N-cyclopropyl-N'-methyl-N'-(4-methylphenyl)butane-1,4-diamine (PubChem CID 62429801) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-N'-(4-methylphenyl)butane-1,4-diamine.
| Compound Name | N-cyclopropyl-N'-methyl-N'-(4-methylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 62429801 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N-cyclopropyl-N'-methyl-N'-(4-methylphenyl)butane-1,4-diamine |
| SMILES | Cc1ccc(N(C)CCCCNC2CC2)cc1 |
| InChI | InChI=1S/C15H24N2/c1-13-5-9-15(10-6-13)17(2)12-4-3-11-16-14-7-8-14/h5-6,9-10,14,16H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | AYJVCQPOVNUVRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|