C17H28N2 — CID 62563445
N-cyclopentyl-N'-(2,4-dimethylphenyl)-N'-methylpropane-1,3-diamine (PubChem CID 62563445) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2,4-dimethylphenyl)-N'-methylpropane-1,3-diamine.
| Compound Name | N-cyclopentyl-N'-(2,4-dimethylphenyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62563445 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-cyclopentyl-N'-(2,4-dimethylphenyl)-N'-methylpropane-1,3-diamine |
| SMILES | Cc1ccc(N(C)CCCNC2CCCC2)c(C)c1 |
| InChI | InChI=1S/C17H28N2/c1-14-9-10-17(15(2)13-14)19(3)12-6-11-18-16-7-4-5-8-16/h9-10,13,16,18H,4-8,11-12H2,1-3H3 |
| InChIKey | FNEFRMYSOVSUJJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|