C16H26N2 — CID 62120655
N-butyl-4-[(cyclopropylamino)methyl]-N,2-dimethylaniline (PubChem CID 62120655) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-butyl-4-[(cyclopropylamino)methyl]-N,2-dimethylaniline.
| Compound Name | N-butyl-4-[(cyclopropylamino)methyl]-N,2-dimethylaniline |
|---|---|
| PubChem CID | 62120655 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-butyl-4-[(cyclopropylamino)methyl]-N,2-dimethylaniline |
| SMILES | CCCCN(C)c1ccc(CNC2CC2)cc1C |
| InChI | InChI=1S/C16H26N2/c1-4-5-10-18(3)16-9-6-14(11-13(16)2)12-17-15-7-8-15/h6,9,11,15,17H,4-5,7-8,10,12H2,1-3H3 |
| InChIKey | XMJZSNNYRZFEJW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|