C16H27N3 — CID 80630395
5-[(cyclopropylamino)methyl]-N,3-dimethyl-N-pentylpyridin-2-amine (PubChem CID 80630395) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N,3-dimethyl-N-pentylpyridin-2-amine.
| Compound Name | 5-[(cyclopropylamino)methyl]-N,3-dimethyl-N-pentylpyridin-2-amine |
|---|---|
| PubChem CID | 80630395 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N,3-dimethyl-N-pentylpyridin-2-amine |
| SMILES | CCCCCN(C)c1ncc(CNC2CC2)cc1C |
| InChI | InChI=1S/C16H27N3/c1-4-5-6-9-19(3)16-13(2)10-14(12-18-16)11-17-15-7-8-15/h10,12,15,17H,4-9,11H2,1-3H3 |
| InChIKey | XFMGGUOQLANZEA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|