C13H21ClN2 — CID 80628542
5-(chloromethyl)-N,3-dimethyl-N-pentylpyridin-2-amine (PubChem CID 80628542) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 5-(chloromethyl)-N,3-dimethyl-N-pentylpyridin-2-amine.
| Compound Name | 5-(chloromethyl)-N,3-dimethyl-N-pentylpyridin-2-amine |
|---|---|
| PubChem CID | 80628542 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-(chloromethyl)-N,3-dimethyl-N-pentylpyridin-2-amine |
| SMILES | CCCCCN(C)c1ncc(CCl)cc1C |
| InChI | InChI=1S/C13H21ClN2/c1-4-5-6-7-16(3)13-11(2)8-12(9-14)10-15-13/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | PBGQHAOKWOKBMD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|