C18H31N3 — CID 80632919
N-butan-2-yl-N-butyl-5-[(cyclopropylamino)methyl]-3-methylpyridin-2-amine (PubChem CID 80632919) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-5-[(cyclopropylamino)methyl]-3-methylpyridin-2-amine.
| Compound Name | N-butan-2-yl-N-butyl-5-[(cyclopropylamino)methyl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 80632919 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | N-butan-2-yl-N-butyl-5-[(cyclopropylamino)methyl]-3-methylpyridin-2-amine |
| SMILES | CCCCN(c1ncc(CNC2CC2)cc1C)C(C)CC |
| InChI | InChI=1S/C18H31N3/c1-5-7-10-21(15(4)6-2)18-14(3)11-16(13-20-18)12-19-17-8-9-17/h11,13,15,17,19H,5-10,12H2,1-4H3 |
| InChIKey | BNFZAUUPMSFIJP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |