C14H22BrN — CID 107080122
4-(bromomethyl)-N,2-dimethyl-N-pentylaniline (PubChem CID 107080122) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 4-(bromomethyl)-N,2-dimethyl-N-pentylaniline.
| Compound Name | 4-(bromomethyl)-N,2-dimethyl-N-pentylaniline |
|---|---|
| PubChem CID | 107080122 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(bromomethyl)-N,2-dimethyl-N-pentylaniline |
| SMILES | CCCCCN(C)c1ccc(CBr)cc1C |
| InChI | InChI=1S/C14H22BrN/c1-4-5-6-9-16(3)14-8-7-13(11-15)10-12(14)2/h7-8,10H,4-6,9,11H2,1-3H3 |
| InChIKey | LHDZKUUXQYCWGU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|