C13H18BrN — CID 107085198
4-(bromomethyl)-N-cyclobutyl-N,2-dimethylaniline (PubChem CID 107085198) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 4-(bromomethyl)-N-cyclobutyl-N,2-dimethylaniline.
| Compound Name | 4-(bromomethyl)-N-cyclobutyl-N,2-dimethylaniline |
|---|---|
| PubChem CID | 107085198 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-(bromomethyl)-N-cyclobutyl-N,2-dimethylaniline |
| SMILES | Cc1cc(CBr)ccc1N(C)C1CCC1 |
| InChI | InChI=1S/C13H18BrN/c1-10-8-11(9-14)6-7-13(10)15(2)12-4-3-5-12/h6-8,12H,3-5,9H2,1-2H3 |
| InChIKey | GWZRYDTXQJDVEN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|