C14H20BrN — CID 107080392
4-(bromomethyl)-N-(1-cyclopropylethyl)-N,2-dimethylaniline (PubChem CID 107080392) has the molecular formula C14H20BrN and a molecular weight of 282.23 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(1-cyclopropylethyl)-N,2-dimethylaniline.
| Compound Name | 4-(bromomethyl)-N-(1-cyclopropylethyl)-N,2-dimethylaniline |
|---|---|
| PubChem CID | 107080392 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(bromomethyl)-N-(1-cyclopropylethyl)-N,2-dimethylaniline |
| SMILES | Cc1cc(CBr)ccc1N(C)C(C)C1CC1 |
| InChI | InChI=1S/C14H20BrN/c1-10-8-12(9-15)4-7-14(10)16(3)11(2)13-5-6-13/h4,7-8,11,13H,5-6,9H2,1-3H3 |
| InChIKey | ZFRJNXNEIJXNEC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|