C16H25BrN2 — CID 107083438
4-(bromomethyl)-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]aniline (PubChem CID 107083438) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 4-(bromomethyl)-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]aniline.
| Compound Name | 4-(bromomethyl)-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 107083438 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-(bromomethyl)-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]aniline |
| SMILES | Cc1cc(CBr)ccc1N(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C16H25BrN2/c1-13-10-15(11-17)4-5-16(13)19(3)12-14-6-8-18(2)9-7-14/h4-5,10,14H,6-9,11-12H2,1-3H3 |
| InChIKey | ACDOJGDGXZVMBF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|