C15H23BrN2 — CID 107083460
4-(bromomethyl)-N,3-dimethyl-N-[(1-methylpyrrolidin-3-yl)methyl]aniline (PubChem CID 107083460) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 4-(bromomethyl)-N,3-dimethyl-N-[(1-methylpyrrolidin-3-yl)methyl]aniline.
| Compound Name | 4-(bromomethyl)-N,3-dimethyl-N-[(1-methylpyrrolidin-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 107083460 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-(bromomethyl)-N,3-dimethyl-N-[(1-methylpyrrolidin-3-yl)methyl]aniline |
| SMILES | Cc1cc(N(C)CC2CCN(C)C2)ccc1CBr |
| InChI | InChI=1S/C15H23BrN2/c1-12-8-15(5-4-14(12)9-16)18(3)11-13-6-7-17(2)10-13/h4-5,8,13H,6-7,9-11H2,1-3H3 |
| InChIKey | HTMYQJJDUXSPRL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|