C13H18ClN — CID 62129636
4-(chloromethyl)-N-(cyclopropylmethyl)-N,3-dimethylaniline (PubChem CID 62129636) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(cyclopropylmethyl)-N,3-dimethylaniline.
| Compound Name | 4-(chloromethyl)-N-(cyclopropylmethyl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 62129636 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-(chloromethyl)-N-(cyclopropylmethyl)-N,3-dimethylaniline |
| SMILES | Cc1cc(N(C)CC2CC2)ccc1CCl |
| InChI | InChI=1S/C13H18ClN/c1-10-7-13(6-5-12(10)8-14)15(2)9-11-3-4-11/h5-7,11H,3-4,8-9H2,1-2H3 |
| InChIKey | RAFJVWWUNQIOJH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|