C12H17BrN2 — CID 43568860
4-bromo-1-N-(1-cyclopropylethyl)-1-N-methylbenzene-1,2-diamine (PubChem CID 43568860) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 4-bromo-1-N-(1-cyclopropylethyl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(1-cyclopropylethyl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43568860 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-bromo-1-N-(1-cyclopropylethyl)-1-N-methylbenzene-1,2-diamine |
| SMILES | CC(C1CC1)N(C)c1ccc(Br)cc1N |
| InChI | InChI=1S/C12H17BrN2/c1-8(9-3-4-9)15(2)12-6-5-10(13)7-11(12)14/h5-9H,3-4,14H2,1-2H3 |
| InChIKey | MULVJDUAICUIGA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|