C14H22BrNS — CID 107084998
4-(bromomethyl)-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline (PubChem CID 107084998) has the molecular formula C14H22BrNS and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-(bromomethyl)-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline.
| Compound Name | 4-(bromomethyl)-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 107084998 |
| Molecular Formula | C14H22BrNS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(bromomethyl)-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline |
| SMILES | CCC(CSC)N(C)c1ccc(CBr)cc1C |
| InChI | InChI=1S/C14H22BrNS/c1-5-13(10-17-4)16(3)14-7-6-12(9-15)8-11(14)2/h6-8,13H,5,9-10H2,1-4H3 |
| InChIKey | YLGDWMCZALTBDE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|