C14H24N2S — CID 112662365
N,2-dimethyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)aniline (PubChem CID 112662365) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N,2-dimethyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)aniline.
| Compound Name | N,2-dimethyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 112662365 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N,2-dimethyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)aniline |
| SMILES | CNCc1ccc(N(C)C(C)CSC)c(C)c1 |
| InChI | InChI=1S/C14H24N2S/c1-11-8-13(9-15-3)6-7-14(11)16(4)12(2)10-17-5/h6-8,12,15H,9-10H2,1-5H3 |
| InChIKey | NZZSADYWRLRUQC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|