C13H22N2S — CID 112662210
N,2-dimethyl-4-(methylaminomethyl)-N-(2-methylsulfanylethyl)aniline (PubChem CID 112662210) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N,2-dimethyl-4-(methylaminomethyl)-N-(2-methylsulfanylethyl)aniline.
| Compound Name | N,2-dimethyl-4-(methylaminomethyl)-N-(2-methylsulfanylethyl)aniline |
|---|---|
| PubChem CID | 112662210 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N,2-dimethyl-4-(methylaminomethyl)-N-(2-methylsulfanylethyl)aniline |
| SMILES | CNCc1ccc(N(C)CCSC)c(C)c1 |
| InChI | InChI=1S/C13H22N2S/c1-11-9-12(10-14-2)5-6-13(11)15(3)7-8-16-4/h5-6,9,14H,7-8,10H2,1-4H3 |
| InChIKey | IMPLAJRGWSZJHB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|