C11H18N2S — CID 112656745
1-N,4-dimethyl-1-N-(2-methylsulfanylethyl)benzene-1,2-diamine (PubChem CID 112656745) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 1-N,4-dimethyl-1-N-(2-methylsulfanylethyl)benzene-1,2-diamine.
| Compound Name | 1-N,4-dimethyl-1-N-(2-methylsulfanylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 112656745 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-N,4-dimethyl-1-N-(2-methylsulfanylethyl)benzene-1,2-diamine |
| SMILES | CSCCN(C)c1ccc(C)cc1N |
| InChI | InChI=1S/C11H18N2S/c1-9-4-5-11(10(12)8-9)13(2)6-7-14-3/h4-5,8H,6-7,12H2,1-3H3 |
| InChIKey | GDZHCMIQMHWJRI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|