C12H19N3OS — CID 114017229
N'-hydroxy-5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide (PubChem CID 114017229) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is N'-hydroxy-5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide.
| Compound Name | N'-hydroxy-5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114017229 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N'-hydroxy-5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide |
| SMILES | CSCCN(C)c1ccc(C)cc1/C(N)=N/O |
| InChI | InChI=1S/C12H19N3OS/c1-9-4-5-11(15(2)6-7-17-3)10(8-9)12(13)14-16/h4-5,8,16H,6-7H2,1-3H3,(H2,13,14) |
| InChIKey | OBMJVMXLRLELBI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|