C14H16ClN3OS — CID 107929819
2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N'-hydroxy-5-methylbenzenecarboximidamide (PubChem CID 107929819) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N'-hydroxy-5-methylbenzenecarboximidamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N'-hydroxy-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107929819 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N'-hydroxy-5-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(N(C)Cc2ccc(Cl)s2)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-9-3-5-12(11(7-9)14(16)17-19)18(2)8-10-4-6-13(15)20-10/h3-7,19H,8H2,1-2H3,(H2,16,17) |
| InChIKey | HORHMFHDLUXFPV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|