C13H12ClF2N3OS — CID 81286314
4-[(5-chlorothiophen-2-yl)methyl-methylamino]-3,5-difluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 81286314) has the molecular formula C13H12ClF2N3OS and a molecular weight of 331.78 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl-methylamino]-3,5-difluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl-methylamino]-3,5-difluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 81286314 |
| Molecular Formula | C13H12ClF2N3OS |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl-methylamino]-3,5-difluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(Cc1ccc(Cl)s1)c1c(F)cc(/C(N)=N/O)cc1F |
| InChI | InChI=1S/C13H12ClF2N3OS/c1-19(6-8-2-3-11(14)21-8)12-9(15)4-7(5-10(12)16)13(17)18-20/h2-5,20H,6H2,1H3,(H2,17,18) |
| InChIKey | RQKXVMATCVLDSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|