C12H12ClN3S2 — CID 61442067
6-[(5-chlorothiophen-2-yl)methyl-methylamino]pyridine-3-carbothioamide (PubChem CID 61442067) has the molecular formula C12H12ClN3S2 and a molecular weight of 297.84 g/mol. Its IUPAC name is 6-[(5-chlorothiophen-2-yl)methyl-methylamino]pyridine-3-carbothioamide.
| Compound Name | 6-[(5-chlorothiophen-2-yl)methyl-methylamino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61442067 |
| Molecular Formula | C12H12ClN3S2 |
| Molecular Weight | 297.84 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 6-[(5-chlorothiophen-2-yl)methyl-methylamino]pyridine-3-carbothioamide |
| SMILES | CN(Cc1ccc(Cl)s1)c1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C12H12ClN3S2/c1-16(7-9-3-4-10(13)18-9)11-5-2-8(6-15-11)12(14)17/h2-6H,7H2,1H3,(H2,14,17) |
| InChIKey | XXOPZYNAZOOLRY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|