C13H14ClN3OS — CID 61438183
5-amino-2-[(5-chlorothiophen-2-yl)methyl-methylamino]benzamide (PubChem CID 61438183) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 5-amino-2-[(5-chlorothiophen-2-yl)methyl-methylamino]benzamide.
| Compound Name | 5-amino-2-[(5-chlorothiophen-2-yl)methyl-methylamino]benzamide |
|---|---|
| PubChem CID | 61438183 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-amino-2-[(5-chlorothiophen-2-yl)methyl-methylamino]benzamide |
| SMILES | CN(Cc1ccc(Cl)s1)c1ccc(N)cc1C(N)=O |
| InChI | InChI=1S/C13H14ClN3OS/c1-17(7-9-3-5-12(14)19-9)11-4-2-8(15)6-10(11)13(16)18/h2-6H,7,15H2,1H3,(H2,16,18) |
| InChIKey | LEROFHXLANCBPU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|