C12H19N3S — CID 107930591
5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide (PubChem CID 107930591) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide.
| Compound Name | 5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107930591 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 5-methyl-2-[methyl(2-methylsulfanylethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)ccc1N(C)CCSC |
| InChI | InChI=1S/C12H19N3S/c1-9-4-5-11(10(8-9)12(13)14)15(2)6-7-16-3/h4-5,8H,6-7H2,1-3H3,(H3,13,14) |
| InChIKey | DEPHQLRTBGKUOP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|