C13H19NOS — CID 62121720
[3-methyl-4-[methyl(thiolan-3-yl)amino]phenyl]methanol (PubChem CID 62121720) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is [3-methyl-4-[methyl(thiolan-3-yl)amino]phenyl]methanol.
| Compound Name | [3-methyl-4-[methyl(thiolan-3-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 62121720 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [3-methyl-4-[methyl(thiolan-3-yl)amino]phenyl]methanol |
| SMILES | Cc1cc(CO)ccc1N(C)C1CCSC1 |
| InChI | InChI=1S/C13H19NOS/c1-10-7-11(8-15)3-4-13(10)14(2)12-5-6-16-9-12/h3-4,7,12,15H,5-6,8-9H2,1-2H3 |
| InChIKey | HSLBEYAUERDEQC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|