C16H24N2S — CID 62119974
N-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-N-methylthiolan-3-amine (PubChem CID 62119974) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is N-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-N-methylthiolan-3-amine.
| Compound Name | N-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-N-methylthiolan-3-amine |
|---|---|
| PubChem CID | 62119974 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-N-methylthiolan-3-amine |
| SMILES | Cc1cc(CNC2CC2)ccc1N(C)C1CCSC1 |
| InChI | InChI=1S/C16H24N2S/c1-12-9-13(10-17-14-4-5-14)3-6-16(12)18(2)15-7-8-19-11-15/h3,6,9,14-15,17H,4-5,7-8,10-11H2,1-2H3 |
| InChIKey | HRRUPNRWJAJXOL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|