C15H23FN2 — CID 55071126
N-cyclopentyl-N'-(2-fluorophenyl)-N'-methylpropane-1,3-diamine (PubChem CID 55071126) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2-fluorophenyl)-N'-methylpropane-1,3-diamine.
| Compound Name | N-cyclopentyl-N'-(2-fluorophenyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55071126 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-cyclopentyl-N'-(2-fluorophenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNC1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C15H23FN2/c1-18(15-10-5-4-9-14(15)16)12-6-11-17-13-7-2-3-8-13/h4-5,9-10,13,17H,2-3,6-8,11-12H2,1H3 |
| InChIKey | KSMUWEIXIVYAEM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|