C18H25FN4O2 — CID 131961894
8-[3-(2-fluoro-N-methylanilino)propylamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 131961894) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is 8-[3-(2-fluoro-N-methylanilino)propylamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[3-(2-fluoro-N-methylanilino)propylamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 131961894 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 8-[3-(2-fluoro-N-methylanilino)propylamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN(CCCNC1CCC2(CC1)NC(=O)NC2=O)c1ccccc1F |
| InChI | InChI=1S/C18H25FN4O2/c1-23(15-6-3-2-5-14(15)19)12-4-11-20-13-7-9-18(10-8-13)16(24)21-17(25)22-18/h2-3,5-6,13,20H,4,7-12H2,1H3,(H2,21,22,24,25) |
| InChIKey | BBGDPRNOSRJREG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|