C16H17F2N3O3 — CID 146087436
2-(2,3-difluorophenyl)-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)acetamide (PubChem CID 146087436) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)acetamide.
| Compound Name | 2-(2,3-difluorophenyl)-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)acetamide |
|---|---|
| PubChem CID | 146087436 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1F)NC1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C16H17F2N3O3/c17-11-3-1-2-9(13(11)18)8-12(22)19-10-4-6-16(7-5-10)14(23)20-15(24)21-16/h1-3,10H,4-8H2,(H,19,22)(H2,20,21,23,24) |
| InChIKey | RWJPJCDCSJKLQX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|