C11H10F3NO — CID 110487434
N-cyclopropyl-2-(2,3,4-trifluorophenyl)acetamide (PubChem CID 110487434) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | N-cyclopropyl-2-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110487434 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-cyclopropyl-2-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1F)NC1CC1 |
| InChI | InChI=1S/C11H10F3NO/c12-8-4-1-6(10(13)11(8)14)5-9(16)15-7-2-3-7/h1,4,7H,2-3,5H2,(H,15,16) |
| InChIKey | BHVXOKDARAOIEY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|