C14H19Cl3N2O — CID 119474323
N-(4-aminocyclohexyl)-2-(2,4-dichlorophenyl)acetamide;hydrochloride (PubChem CID 119474323) has the molecular formula C14H19Cl3N2O and a molecular weight of 337.68 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(2,4-dichlorophenyl)acetamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(2,4-dichlorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119474323 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(2,4-dichlorophenyl)acetamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O.ClH/c15-10-2-1-9(13(16)8-10)7-14(19)18-12-5-3-11(17)4-6-12;/h1-2,8,11-12H,3-7,17H2,(H,18,19);1H |
| InChIKey | FIEPGFLTEQMHLB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |