C20H21Cl2NO — CID 22076139
2-(2,4-dichlorophenyl)-N-(4-phenylcyclohexyl)acetamide (PubChem CID 22076139) has the molecular formula C20H21Cl2NO and a molecular weight of 362.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(4-phenylcyclohexyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(4-phenylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 22076139 |
| Molecular Formula | C20H21Cl2NO |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(4-phenylcyclohexyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21Cl2NO/c21-17-9-6-16(19(22)13-17)12-20(24)23-18-10-7-15(8-11-18)14-4-2-1-3-5-14/h1-6,9,13,15,18H,7-8,10-12H2,(H,23,24) |
| InChIKey | BWXARPZKCGCBOQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |