C17H14Cl2O — CID 116516992
2-(2,4-dichlorophenyl)-1-(2-phenylcyclopropyl)ethanone (PubChem CID 116516992) has the molecular formula C17H14Cl2O and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(2-phenylcyclopropyl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(2-phenylcyclopropyl)ethanone |
|---|---|
| PubChem CID | 116516992 |
| Molecular Formula | C17H14Cl2O |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(2-phenylcyclopropyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)C1CC1c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2O/c18-13-7-6-12(16(19)9-13)8-17(20)15-10-14(15)11-4-2-1-3-5-11/h1-7,9,14-15H,8,10H2 |
| InChIKey | MUJZQGNVXUVSDI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |