2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid

C12H12Cl2O2 — CID 83928405

IUPAC2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid
SMILESO=C(O)C1CC1CCc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H12Cl2O2/c13-9-4-3-7(11(14)6-9)1-2-8-5-10(8)12(15)16/h3-4,6,8,10H,1-2,5H2,(H,15,16)
InChIKeyDLHTVWYNPLLWIS-UHFFFAOYSA-N
MW259.13 g/mol
LogP3.65
Rot. Bonds4

About 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid

2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 83928405) has the molecular formula C12H12Cl2O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid
PubChem CID83928405
Molecular FormulaC12H12Cl2O2
Molecular Weight259.13 g/mol
Exact Mass258.02
IUPAC Name2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid
SMILESO=C(O)C1CC1CCc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H12Cl2O2/c13-9-4-3-7(11(14)6-9)1-2-8-5-10(8)12(15)16/h3-4,6,8,10H,1-2,5H2,(H,15,16)
InChIKeyDLHTVWYNPLLWIS-UHFFFAOYSA-N
XLogP3.65
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.13
LogP ≤ 53.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid (CID 83928405) is 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid is O=C(O)C1CC1CCc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid?
The InChIKey is DLHTVWYNPLLWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2O2/c13-9-4-3-7(11(14)6-9)1-2-8-5-10(8)12(15)16/h3-4,6,8,10H,1-2,5H2,(H,15,16).
What are the key properties of 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid?
2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid has a molecular weight of 259.13 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenyl)ethyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 83928405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).