C10H10Cl2O2S — CID 28813945
2-[2-(2,4-dichlorophenyl)ethylsulfanyl]acetic acid (PubChem CID 28813945) has the molecular formula C10H10Cl2O2S and a molecular weight of 265.16 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 28813945 |
| Molecular Formula | C10H10Cl2O2S |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2O2S/c11-8-2-1-7(9(12)5-8)3-4-15-6-10(13)14/h1-2,5H,3-4,6H2,(H,13,14) |
| InChIKey | MUSALNKKCGSSQH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|