C14H8Cl4O2 — CID 134622770
2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid (PubChem CID 134622770) has the molecular formula C14H8Cl4O2 and a molecular weight of 350.03 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid.
| Compound Name | 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134622770 |
| Molecular Formula | C14H8Cl4O2 |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2c(Cl)cc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl4O2/c15-9-5-11(17)14(12(18)6-9)8-2-1-7(4-13(19)20)10(16)3-8/h1-3,5-6H,4H2,(H,19,20) |
| InChIKey | NCJLQRJCEILQED-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |