2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid

C14H8Cl4O2 — CID 134622770

IUPAC2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(-c2c(Cl)cc(Cl)cc2Cl)cc1Cl
InChIInChI=1S/C14H8Cl4O2/c15-9-5-11(17)14(12(18)6-9)8-2-1-7(4-13(19)20)10(16)3-8/h1-3,5-6H,4H2,(H,19,20)
InChIKeyNCJLQRJCEILQED-UHFFFAOYSA-N
MW350.03 g/mol
LogP5.59
Rot. Bonds3

About 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid

2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid (PubChem CID 134622770) has the molecular formula C14H8Cl4O2 and a molecular weight of 350.03 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid.

Molecular Properties

Compound Name2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid
PubChem CID134622770
Molecular FormulaC14H8Cl4O2
Molecular Weight350.03 g/mol
Exact Mass347.93
IUPAC Name2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(-c2c(Cl)cc(Cl)cc2Cl)cc1Cl
InChIInChI=1S/C14H8Cl4O2/c15-9-5-11(17)14(12(18)6-9)8-2-1-7(4-13(19)20)10(16)3-8/h1-3,5-6H,4H2,(H,19,20)
InChIKeyNCJLQRJCEILQED-UHFFFAOYSA-N
XLogP5.59
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500350.03
LogP ≤ 55.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid?
The IUPAC name of 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid (CID 134622770) is 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid.
What is the SMILES notation for 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid?
The canonical SMILES for 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid is O=C(O)Cc1ccc(-c2c(Cl)cc(Cl)cc2Cl)cc1Cl.
What is the InChIKey of 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid?
The InChIKey is NCJLQRJCEILQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl4O2/c15-9-5-11(17)14(12(18)6-9)8-2-1-7(4-13(19)20)10(16)3-8/h1-3,5-6H,4H2,(H,19,20).
What are the key properties of 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid?
2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid has a molecular weight of 350.03 g/mol, XLogP of 5.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-(2,4,6-trichlorophenyl)phenyl]acetic acid is sourced from PubChem (CID 134622770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).