C14H9Cl3O2 — CID 176516194
2-[2-chloro-4-(2,5-dichlorophenyl)phenyl]acetic acid (PubChem CID 176516194) has the molecular formula C14H9Cl3O2 and a molecular weight of 315.58 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,5-dichlorophenyl)phenyl]acetic acid.
| Compound Name | 2-[2-chloro-4-(2,5-dichlorophenyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 176516194 |
| Molecular Formula | C14H9Cl3O2 |
| Molecular Weight | 315.58 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2-[2-chloro-4-(2,5-dichlorophenyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2cc(Cl)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3O2/c15-10-3-4-12(16)11(7-10)8-1-2-9(6-14(18)19)13(17)5-8/h1-5,7H,6H2,(H,18,19) |
| InChIKey | RTZCKHWYJJKVPB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |