C13H8Cl2FNO2 — CID 133090909
2-[2-(2,5-dichlorophenyl)-6-fluoro-3-pyridinyl]acetic acid (PubChem CID 133090909) has the molecular formula C13H8Cl2FNO2 and a molecular weight of 300.12 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)-6-fluoro-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-(2,5-dichlorophenyl)-6-fluoro-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133090909 |
| Molecular Formula | C13H8Cl2FNO2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)-6-fluoro-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(F)nc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H8Cl2FNO2/c14-8-2-3-10(15)9(6-8)13-7(5-12(18)19)1-4-11(16)17-13/h1-4,6H,5H2,(H,18,19) |
| InChIKey | ZSPWTSVWEVSFIT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|