C13H7Cl2F2NO2 — CID 133091115
2-[6-(2,4-dichlorophenyl)-3,5-difluoro-2-pyridinyl]acetic acid (PubChem CID 133091115) has the molecular formula C13H7Cl2F2NO2 and a molecular weight of 318.11 g/mol. Its IUPAC name is 2-[6-(2,4-dichlorophenyl)-3,5-difluoro-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-(2,4-dichlorophenyl)-3,5-difluoro-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133091115 |
| Molecular Formula | C13H7Cl2F2NO2 |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 2-[6-(2,4-dichlorophenyl)-3,5-difluoro-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1nc(-c2ccc(Cl)cc2Cl)c(F)cc1F |
| InChI | InChI=1S/C13H7Cl2F2NO2/c14-6-1-2-7(8(15)3-6)13-10(17)4-9(16)11(18-13)5-12(19)20/h1-4H,5H2,(H,19,20) |
| InChIKey | RHELOPWDNBRIOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |